C21H29N3O3S — CID 23328053
2-[methyl-[(E)-2-phenylethenyl]sulfonylamino]-N-[(Z)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]acetamide (PubChem CID 23328053) has the molecular formula C21H29N3O3S and a molecular weight of 403.55 g/mol. Its IUPAC name is 2-[methyl-[(E)-2-phenylethenyl]sulfonylamino]-N-[(Z)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]acetamide.
| Compound Name | 2-[methyl-[(E)-2-phenylethenyl]sulfonylamino]-N-[(Z)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]acetamide |
|---|---|
| PubChem CID | 23328053 |
| Molecular Formula | C21H29N3O3S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 2-[methyl-[(E)-2-phenylethenyl]sulfonylamino]-N-[(Z)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]acetamide |
| SMILES | CN(CC(=O)N/N=C1/C[C@@H]2CC[C@]1(C)C2(C)C)S(=O)(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C21H29N3O3S/c1-20(2)17-10-12-21(20,3)18(14-17)22-23-19(25)15-24(4)28(26,27)13-11-16-8-6-5-7-9-16/h5-9,11,13,17H,10,12,14-15H2,1-4H3,(H,23,25)/b13-11+,22-18-/t17-,21-/m0/s1 |
| InChIKey | QMKUKDOHGSFDMH-KKLFBUDWSA-N |
| XLogP | 3.24 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|