C21H25N3O3 — CID 23328123
2-(1,3-dioxo-4H-isoquinolin-2-yl)-N-[(E)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]acetamide (PubChem CID 23328123) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 2-(1,3-dioxo-4H-isoquinolin-2-yl)-N-[(E)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]acetamide.
| Compound Name | 2-(1,3-dioxo-4H-isoquinolin-2-yl)-N-[(E)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]acetamide |
|---|---|
| PubChem CID | 23328123 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 2-(1,3-dioxo-4H-isoquinolin-2-yl)-N-[(E)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]acetamide |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)/C(=N/NC(=O)CN1C(=O)Cc3ccccc3C1=O)C2 |
| InChI | InChI=1S/C21H25N3O3/c1-20(2)14-8-9-21(20,3)16(11-14)22-23-17(25)12-24-18(26)10-13-6-4-5-7-15(13)19(24)27/h4-7,14H,8-12H2,1-3H3,(H,23,25)/b22-16+/t14-,21-/m0/s1 |
| InChIKey | MULRRJWSCHTHKE-IIEKNUQRSA-N |
| XLogP | 2.53 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|