C8H13FO3S — CID 23328450
[(1R,2R,4R,7R)-2-fluoro-7-bicyclo[2.2.1]heptanyl] methanesulfonate (PubChem CID 23328450) has the molecular formula C8H13FO3S and a molecular weight of 208.25 g/mol. Its IUPAC name is [(1R,2R,4R,7R)-2-fluoro-7-bicyclo[2.2.1]heptanyl] methanesulfonate.
| Compound Name | [(1R,2R,4R,7R)-2-fluoro-7-bicyclo[2.2.1]heptanyl] methanesulfonate |
|---|---|
| PubChem CID | 23328450 |
| Molecular Formula | C8H13FO3S |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | [(1R,2R,4R,7R)-2-fluoro-7-bicyclo[2.2.1]heptanyl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@H]1[C@@H]2CC[C@H]1[C@H](F)C2 |
| InChI | InChI=1S/C8H13FO3S/c1-13(10,11)12-8-5-2-3-6(8)7(9)4-5/h5-8H,2-4H2,1H3/t5-,6+,7-,8-/m1/s1 |
| InChIKey | SKCRQDBNUZDNEK-ULAWRXDQSA-N |
| XLogP | 1.10 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|