C9H6N4O3S2 — CID 2332846
5,13-bis(sulfanylidene)-2-oxa-4,6,12,14-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8)-diene-7,11-dione (PubChem CID 2332846) has the molecular formula C9H6N4O3S2 and a molecular weight of 282.31 g/mol. Its IUPAC name is 5,13-bis(sulfanylidene)-2-oxa-4,6,12,14-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8)-diene-7,11-dione.
| Compound Name | 5,13-bis(sulfanylidene)-2-oxa-4,6,12,14-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8)-diene-7,11-dione |
|---|---|
| PubChem CID | 2332846 |
| Molecular Formula | C9H6N4O3S2 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | 5,13-bis(sulfanylidene)-2-oxa-4,6,12,14-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8)-diene-7,11-dione |
| SMILES | O=c1[nH]c(=S)[nH]c2c1Cc1c([nH]c(=S)[nH]c1=O)O2 |
| InChI | InChI=1S/C9H6N4O3S2/c14-4-2-1-3-5(15)11-9(18)13-7(3)16-6(2)12-8(17)10-4/h1H2,(H2,10,12,14,17)(H2,11,13,15,18) |
| InChIKey | TWOXWOYTBFKSSM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|