About 2-[5-(trifluoromethyl)-1,2-oxazol-3-yl]acetic acid
2-[5-(trifluoromethyl)-1,2-oxazol-3-yl]acetic acid (PubChem CID 2333001) has the molecular formula C6H4F3NO3
and a molecular weight of 195.10 g/mol. Its IUPAC name is 2-[5-(trifluoromethyl)-1,2-oxazol-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[5-(trifluoromethyl)-1,2-oxazol-3-yl]acetic acid |
| PubChem CID | 2333001 |
| Molecular Formula | C6H4F3NO3 |
| Molecular Weight | 195.10 g/mol |
| Exact Mass | 195.01 |
| IUPAC Name | 2-[5-(trifluoromethyl)-1,2-oxazol-3-yl]acetic acid |
| SMILES | O=C(O)Cc1cc(C(F)(F)F)on1 |
| InChI | InChI=1S/C6H4F3NO3/c7-6(8,9)4-1-3(10-13-4)2-5(11)12/h1H,2H2,(H,11,12) |
| InChIKey | PWRWAHNRFUWSCG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.10 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[5-(trifluoromethyl)-1,2-oxazol-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(trifluoromethyl)-1,2-oxazol-3-yl]acetic acid?
The IUPAC name of 2-[5-(trifluoromethyl)-1,2-oxazol-3-yl]acetic acid (CID 2333001) is 2-[5-(trifluoromethyl)-1,2-oxazol-3-yl]acetic acid.
What is the SMILES notation for 2-[5-(trifluoromethyl)-1,2-oxazol-3-yl]acetic acid?
The canonical SMILES for 2-[5-(trifluoromethyl)-1,2-oxazol-3-yl]acetic acid is O=C(O)Cc1cc(C(F)(F)F)on1.
What is the InChIKey of 2-[5-(trifluoromethyl)-1,2-oxazol-3-yl]acetic acid?
The InChIKey is PWRWAHNRFUWSCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F3NO3/c7-6(8,9)4-1-3(10-13-4)2-5(11)12/h1H,2H2,(H,11,12).
What are the key properties of 2-[5-(trifluoromethyl)-1,2-oxazol-3-yl]acetic acid?
2-[5-(trifluoromethyl)-1,2-oxazol-3-yl]acetic acid has a molecular weight of 195.10 g/mol, XLogP of 1.32, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(trifluoromethyl)-1,2-oxazol-3-yl]acetic acid is sourced from PubChem (CID 2333001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).