C10H18N2O4 — CID 23330011
1,8-dioxa-4,11-diazacyclotetradecane-3,10-dione (PubChem CID 23330011) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is 1,8-dioxa-4,11-diazacyclotetradecane-3,10-dione.
| Compound Name | 1,8-dioxa-4,11-diazacyclotetradecane-3,10-dione |
|---|---|
| PubChem CID | 23330011 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 1,8-dioxa-4,11-diazacyclotetradecane-3,10-dione |
| SMILES | O=C1COCCCNC(=O)COCCCN1 |
| InChI | InChI=1S/C10H18N2O4/c13-9-8-16-6-2-4-12-10(14)7-15-5-1-3-11-9/h1-8H2,(H,11,13)(H,12,14) |
| InChIKey | WPQBCKTXSSGBFS-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |