About prop-2-enyl 3-tris(3-oxo-3-prop-2-enoxypropyl)stannylpropanoate
prop-2-enyl 3-tris(3-oxo-3-prop-2-enoxypropyl)stannylpropanoate (PubChem CID 23330193) has the molecular formula C24H36O8Sn
and a molecular weight of 571.26 g/mol. Its IUPAC name is prop-2-enyl 3-tris(3-oxo-3-prop-2-enoxypropyl)stannylpropanoate.
Molecular Properties
| Compound Name | prop-2-enyl 3-tris(3-oxo-3-prop-2-enoxypropyl)stannylpropanoate |
| PubChem CID | 23330193 |
| Molecular Formula | C24H36O8Sn |
| Molecular Weight | 571.26 g/mol |
| Exact Mass | 572.14 |
| IUPAC Name | prop-2-enyl 3-tris(3-oxo-3-prop-2-enoxypropyl)stannylpropanoate |
| SMILES | C=CCOC(=O)CC[Sn](CCC(=O)OCC=C)(CCC(=O)OCC=C)CCC(=O)OCC=C |
| InChI | InChI=1S/4C6H9O2.Sn/c4*1-3-5-8-6(7)4-2;/h4*3H,1-2,4-5H2; |
| InChIKey | NMFSMCIFXICFGB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 571.26 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 3-tris(3-oxo-3-prop-2-enoxypropyl)stannylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 3-tris(3-oxo-3-prop-2-enoxypropyl)stannylpropanoate?
The IUPAC name of prop-2-enyl 3-tris(3-oxo-3-prop-2-enoxypropyl)stannylpropanoate (CID 23330193) is prop-2-enyl 3-tris(3-oxo-3-prop-2-enoxypropyl)stannylpropanoate.
What is the SMILES notation for prop-2-enyl 3-tris(3-oxo-3-prop-2-enoxypropyl)stannylpropanoate?
The canonical SMILES for prop-2-enyl 3-tris(3-oxo-3-prop-2-enoxypropyl)stannylpropanoate is C=CCOC(=O)CC[Sn](CCC(=O)OCC=C)(CCC(=O)OCC=C)CCC(=O)OCC=C.
What is the InChIKey of prop-2-enyl 3-tris(3-oxo-3-prop-2-enoxypropyl)stannylpropanoate?
The InChIKey is NMFSMCIFXICFGB-UHFFFAOYSA-N. The full InChI is InChI=1S/4C6H9O2.Sn/c4*1-3-5-8-6(7)4-2;/h4*3H,1-2,4-5H2;.
What are the key properties of prop-2-enyl 3-tris(3-oxo-3-prop-2-enoxypropyl)stannylpropanoate?
prop-2-enyl 3-tris(3-oxo-3-prop-2-enoxypropyl)stannylpropanoate has a molecular weight of 571.26 g/mol, XLogP of 3.91, 20 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 3-tris(3-oxo-3-prop-2-enoxypropyl)stannylpropanoate is sourced from PubChem (CID 23330193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).