About 6-ethyl-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one
6-ethyl-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 23330414) has the molecular formula C9H10N2OS
and a molecular weight of 194.26 g/mol. Its IUPAC name is 6-ethyl-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 6-ethyl-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one |
| PubChem CID | 23330414 |
| Molecular Formula | C9H10N2OS |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 6-ethyl-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | CCc1sc2nc[nH]c(=O)c2c1C |
| InChI | InChI=1S/C9H10N2OS/c1-3-6-5(2)7-8(12)10-4-11-9(7)13-6/h4H,3H2,1-2H3,(H,10,11,12) |
| InChIKey | TTZNLAZLSPLTAK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-ethyl-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one?
The IUPAC name of 6-ethyl-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one (CID 23330414) is 6-ethyl-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 6-ethyl-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one?
The canonical SMILES for 6-ethyl-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one is CCc1sc2nc[nH]c(=O)c2c1C.
What is the InChIKey of 6-ethyl-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one?
The InChIKey is TTZNLAZLSPLTAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2OS/c1-3-6-5(2)7-8(12)10-4-11-9(7)13-6/h4H,3H2,1-2H3,(H,10,11,12).
What are the key properties of 6-ethyl-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one?
6-ethyl-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one has a molecular weight of 194.26 g/mol, XLogP of 1.86, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 23330414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).