C4H7N3S2 — CID 23330707
1-ethyl-1,2,4-triazolidine-3,5-dithione (PubChem CID 23330707) has the molecular formula C4H7N3S2 and a molecular weight of 161.25 g/mol. Its IUPAC name is 1-ethyl-1,2,4-triazolidine-3,5-dithione.
| Compound Name | 1-ethyl-1,2,4-triazolidine-3,5-dithione |
|---|---|
| PubChem CID | 23330707 |
| Molecular Formula | C4H7N3S2 |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.01 |
| IUPAC Name | 1-ethyl-1,2,4-triazolidine-3,5-dithione |
| SMILES | CCn1[nH]c(=S)[nH]c1=S |
| InChI | InChI=1S/C4H7N3S2/c1-2-7-4(9)5-3(8)6-7/h2H2,1H3,(H2,5,6,8,9) |
| InChIKey | FWOVGNAZOFNXHH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 36.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|