C56H84N2O6 — CID 23330840
[1-[2-[4-(3,5-ditert-butyl-4-hydroxybenzoyl)oxy-2,2,6,6-tetramethylpiperidin-1-yl]-3,6-dimethylphenyl]-2,2,6,6-tetramethylpiperidin-4-yl] 3,5-ditert-butyl-4-hydroxybenzoate (PubChem CID 23330840) has the molecular formula C56H84N2O6 and a molecular weight of 881.30 g/mol. Its IUPAC name is [1-[2-[4-(3,5-ditert-butyl-4-hydroxybenzoyl)oxy-2,2,6,6-tetramethylpiperidin-1-yl]-3,6-dimethylphenyl]-2,2,6,6-tetramethylpiperidin-4-yl] 3,5-ditert-butyl-4-hydroxybenzoate.
| Compound Name | [1-[2-[4-(3,5-ditert-butyl-4-hydroxybenzoyl)oxy-2,2,6,6-tetramethylpiperidin-1-yl]-3,6-dimethylphenyl]-2,2,6,6-tetramethylpiperidin-4-yl] 3,5-ditert-butyl-4-hydroxybenzoate |
|---|---|
| PubChem CID | 23330840 |
| Molecular Formula | C56H84N2O6 |
| Molecular Weight | 881.30 g/mol |
| Exact Mass | 880.63 |
| IUPAC Name | [1-[2-[4-(3,5-ditert-butyl-4-hydroxybenzoyl)oxy-2,2,6,6-tetramethylpiperidin-1-yl]-3,6-dimethylphenyl]-2,2,6,6-tetramethylpiperidin-4-yl] 3,5-ditert-butyl-4-hydroxybenzoate |
| SMILES | Cc1ccc(C)c(N2C(C)(C)CC(OC(=O)c3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)CC2(C)C)c1N1C(C)(C)CC(OC(=O)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)CC1(C)C |
| InChI | InChI=1S/C56H84N2O6/c1-33-23-24-34(2)44(58-55(19,20)31-38(32-56(58,21)22)64-48(62)36-27-41(51(9,10)11)46(60)42(28-36)52(12,13)14)43(33)57-53(15,16)29-37(30-54(57,17)18)63-47(61)35-25-39(49(3,4)5)45(59)40(26-35)50(6,7)8/h23-28,37-38,59-60H,29-32H2,1-22H3 |
| InChIKey | XORWJMWOWFBURD-UHFFFAOYSA-N |
| XLogP | 13.67 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.30 |
| LogP ≤ 5 | 13.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |