C15H22ClNO — CID 23331338
7-methoxy-4-methyl-3-prop-2-enyl-1,2,4,5-tetrahydro-3-benzazepine;hydrochloride (PubChem CID 23331338) has the molecular formula C15H22ClNO and a molecular weight of 267.80 g/mol. Its IUPAC name is 7-methoxy-4-methyl-3-prop-2-enyl-1,2,4,5-tetrahydro-3-benzazepine;hydrochloride.
| Compound Name | 7-methoxy-4-methyl-3-prop-2-enyl-1,2,4,5-tetrahydro-3-benzazepine;hydrochloride |
|---|---|
| PubChem CID | 23331338 |
| Molecular Formula | C15H22ClNO |
| Molecular Weight | 267.80 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 7-methoxy-4-methyl-3-prop-2-enyl-1,2,4,5-tetrahydro-3-benzazepine;hydrochloride |
| SMILES | C=CCN1CCc2ccc(OC)cc2CC1C.Cl |
| InChI | InChI=1S/C15H21NO.ClH/c1-4-8-16-9-7-13-5-6-15(17-3)11-14(13)10-12(16)2;/h4-6,11-12H,1,7-10H2,2-3H3;1H |
| InChIKey | SSLGWSPUDANMBQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.80 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|