About 6-fluoro-1,1-dioxo-1,2-benzothiazol-3-one
6-fluoro-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 23331601) has the molecular formula C7H4FNO3S
and a molecular weight of 201.18 g/mol. Its IUPAC name is 6-fluoro-1,1-dioxo-1,2-benzothiazol-3-one.
Molecular Properties
| Compound Name | 6-fluoro-1,1-dioxo-1,2-benzothiazol-3-one |
| PubChem CID | 23331601 |
| Molecular Formula | C7H4FNO3S |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 200.99 |
| IUPAC Name | 6-fluoro-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | O=C1NS(=O)(=O)c2cc(F)ccc21 |
| InChI | InChI=1S/C7H4FNO3S/c8-4-1-2-5-6(3-4)13(11,12)9-7(5)10/h1-3H,(H,9,10) |
| InChIKey | KEOZGOWEMVYVGD-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-fluoro-1,1-dioxo-1,2-benzothiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-1,1-dioxo-1,2-benzothiazol-3-one?
The IUPAC name of 6-fluoro-1,1-dioxo-1,2-benzothiazol-3-one (CID 23331601) is 6-fluoro-1,1-dioxo-1,2-benzothiazol-3-one.
What is the SMILES notation for 6-fluoro-1,1-dioxo-1,2-benzothiazol-3-one?
The canonical SMILES for 6-fluoro-1,1-dioxo-1,2-benzothiazol-3-one is O=C1NS(=O)(=O)c2cc(F)ccc21.
What is the InChIKey of 6-fluoro-1,1-dioxo-1,2-benzothiazol-3-one?
The InChIKey is KEOZGOWEMVYVGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4FNO3S/c8-4-1-2-5-6(3-4)13(11,12)9-7(5)10/h1-3H,(H,9,10).
What are the key properties of 6-fluoro-1,1-dioxo-1,2-benzothiazol-3-one?
6-fluoro-1,1-dioxo-1,2-benzothiazol-3-one has a molecular weight of 201.18 g/mol, XLogP of 0.26, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-1,1-dioxo-1,2-benzothiazol-3-one is sourced from PubChem (CID 23331601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).