C16H14N8 — CID 23331629
13-ethyl-4-methyl-8-pyrazol-1-yl-2,3,7,11,13,14-hexazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(16),3,5,7,9,11,14-heptaene (PubChem CID 23331629) has the molecular formula C16H14N8 and a molecular weight of 318.34 g/mol. Its IUPAC name is 13-ethyl-4-methyl-8-pyrazol-1-yl-2,3,7,11,13,14-hexazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(16),3,5,7,9,11,14-heptaene.
| Compound Name | 13-ethyl-4-methyl-8-pyrazol-1-yl-2,3,7,11,13,14-hexazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(16),3,5,7,9,11,14-heptaene |
|---|---|
| PubChem CID | 23331629 |
| Molecular Formula | C16H14N8 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 13-ethyl-4-methyl-8-pyrazol-1-yl-2,3,7,11,13,14-hexazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(16),3,5,7,9,11,14-heptaene |
| SMILES | CCn1ncc2c1ncc1c(-n3cccn3)nc3cc(C)nn3c12 |
| InChI | InChI=1S/C16H14N8/c1-3-22-15-12(9-19-22)14-11(8-17-15)16(23-6-4-5-18-23)20-13-7-10(2)21-24(13)14/h4-9H,3H2,1-2H3 |
| InChIKey | OBYUFZIYYHWKQF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 78.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |