C17H19N7O2 — CID 23331652
4-(diethylamino)-13-ethyl-2,3,7,11,13,14-hexazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(16),3,5,7,9,11,14-heptaene-5-carboxylic acid (PubChem CID 23331652) has the molecular formula C17H19N7O2 and a molecular weight of 353.39 g/mol. Its IUPAC name is 4-(diethylamino)-13-ethyl-2,3,7,11,13,14-hexazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(16),3,5,7,9,11,14-heptaene-5-carboxylic acid.
| Compound Name | 4-(diethylamino)-13-ethyl-2,3,7,11,13,14-hexazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(16),3,5,7,9,11,14-heptaene-5-carboxylic acid |
|---|---|
| PubChem CID | 23331652 |
| Molecular Formula | C17H19N7O2 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 4-(diethylamino)-13-ethyl-2,3,7,11,13,14-hexazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(16),3,5,7,9,11,14-heptaene-5-carboxylic acid |
| SMILES | CCN(CC)c1nn2c(ncc3cnc4c(cnn4CC)c32)c1C(=O)O |
| InChI | InChI=1S/C17H19N7O2/c1-4-22(5-2)16-12(17(25)26)15-19-8-10-7-18-14-11(9-20-23(14)6-3)13(10)24(15)21-16/h7-9H,4-6H2,1-3H3,(H,25,26) |
| InChIKey | GQLUNHVJJONSRL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 101.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |