About N-tert-butyl-4,5-dimethylthiophene-2-sulfonamide
N-tert-butyl-4,5-dimethylthiophene-2-sulfonamide (PubChem CID 23331882) has the molecular formula C10H17NO2S2
and a molecular weight of 247.38 g/mol. Its IUPAC name is N-tert-butyl-4,5-dimethylthiophene-2-sulfonamide.
Molecular Properties
| Compound Name | N-tert-butyl-4,5-dimethylthiophene-2-sulfonamide |
| PubChem CID | 23331882 |
| Molecular Formula | C10H17NO2S2 |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | N-tert-butyl-4,5-dimethylthiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC(C)(C)C)sc1C |
| InChI | InChI=1S/C10H17NO2S2/c1-7-6-9(14-8(7)2)15(12,13)11-10(3,4)5/h6,11H,1-5H3 |
| InChIKey | WEFNXWUDTSZVGZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-tert-butyl-4,5-dimethylthiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-4,5-dimethylthiophene-2-sulfonamide?
The IUPAC name of N-tert-butyl-4,5-dimethylthiophene-2-sulfonamide (CID 23331882) is N-tert-butyl-4,5-dimethylthiophene-2-sulfonamide.
What is the SMILES notation for N-tert-butyl-4,5-dimethylthiophene-2-sulfonamide?
The canonical SMILES for N-tert-butyl-4,5-dimethylthiophene-2-sulfonamide is Cc1cc(S(=O)(=O)NC(C)(C)C)sc1C.
What is the InChIKey of N-tert-butyl-4,5-dimethylthiophene-2-sulfonamide?
The InChIKey is WEFNXWUDTSZVGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2S2/c1-7-6-9(14-8(7)2)15(12,13)11-10(3,4)5/h6,11H,1-5H3.
What are the key properties of N-tert-butyl-4,5-dimethylthiophene-2-sulfonamide?
N-tert-butyl-4,5-dimethylthiophene-2-sulfonamide has a molecular weight of 247.38 g/mol, XLogP of 2.44, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-4,5-dimethylthiophene-2-sulfonamide is sourced from PubChem (CID 23331882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).