About 4-N,4-N-diethylbenzene-1,2,4-triamine
4-N,4-N-diethylbenzene-1,2,4-triamine (PubChem CID 23331908) has the molecular formula C10H17N3
and a molecular weight of 179.27 g/mol. Its IUPAC name is 4-N,4-N-diethylbenzene-1,2,4-triamine.
Molecular Properties
| Compound Name | 4-N,4-N-diethylbenzene-1,2,4-triamine |
| PubChem CID | 23331908 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 4-N,4-N-diethylbenzene-1,2,4-triamine |
| SMILES | CCN(CC)c1ccc(N)c(N)c1 |
| InChI | InChI=1S/C10H17N3/c1-3-13(4-2)8-5-6-9(11)10(12)7-8/h5-7H,3-4,11-12H2,1-2H3 |
| InChIKey | WBESZLACIAKKAS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-N,4-N-diethylbenzene-1,2,4-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N,4-N-diethylbenzene-1,2,4-triamine?
The IUPAC name of 4-N,4-N-diethylbenzene-1,2,4-triamine (CID 23331908) is 4-N,4-N-diethylbenzene-1,2,4-triamine.
What is the SMILES notation for 4-N,4-N-diethylbenzene-1,2,4-triamine?
The canonical SMILES for 4-N,4-N-diethylbenzene-1,2,4-triamine is CCN(CC)c1ccc(N)c(N)c1.
What is the InChIKey of 4-N,4-N-diethylbenzene-1,2,4-triamine?
The InChIKey is WBESZLACIAKKAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3/c1-3-13(4-2)8-5-6-9(11)10(12)7-8/h5-7H,3-4,11-12H2,1-2H3.
What are the key properties of 4-N,4-N-diethylbenzene-1,2,4-triamine?
4-N,4-N-diethylbenzene-1,2,4-triamine has a molecular weight of 179.27 g/mol, XLogP of 1.70, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N,4-N-diethylbenzene-1,2,4-triamine is sourced from PubChem (CID 23331908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).