C25H22ClFN2O3 — CID 23332415
[cyano-(4-fluoro-3-phenoxyphenyl)methyl] 2-(2-chloroanilino)-3-methylbutanoate (PubChem CID 23332415) has the molecular formula C25H22ClFN2O3 and a molecular weight of 452.91 g/mol. Its IUPAC name is [cyano-(4-fluoro-3-phenoxyphenyl)methyl] 2-(2-chloroanilino)-3-methylbutanoate.
| Compound Name | [cyano-(4-fluoro-3-phenoxyphenyl)methyl] 2-(2-chloroanilino)-3-methylbutanoate |
|---|---|
| PubChem CID | 23332415 |
| Molecular Formula | C25H22ClFN2O3 |
| Molecular Weight | 452.91 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | [cyano-(4-fluoro-3-phenoxyphenyl)methyl] 2-(2-chloroanilino)-3-methylbutanoate |
| SMILES | CC(C)C(Nc1ccccc1Cl)C(=O)OC(C#N)c1ccc(F)c(Oc2ccccc2)c1 |
| InChI | InChI=1S/C25H22ClFN2O3/c1-16(2)24(29-21-11-7-6-10-19(21)26)25(30)32-23(15-28)17-12-13-20(27)22(14-17)31-18-8-4-3-5-9-18/h3-14,16,23-24,29H,1-2H3 |
| InChIKey | FYRDOXSQDFLAPE-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.91 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |