C15H9ClF2N2O — CID 23332589
5-(2-chlorophenyl)-3,7-difluoro-1,3-dihydro-1,4-benzodiazepin-2-one (PubChem CID 23332589) has the molecular formula C15H9ClF2N2O and a molecular weight of 306.70 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-3,7-difluoro-1,3-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | 5-(2-chlorophenyl)-3,7-difluoro-1,3-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 23332589 |
| Molecular Formula | C15H9ClF2N2O |
| Molecular Weight | 306.70 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 5-(2-chlorophenyl)-3,7-difluoro-1,3-dihydro-1,4-benzodiazepin-2-one |
| SMILES | O=C1Nc2ccc(F)cc2C(c2ccccc2Cl)=NC1F |
| InChI | InChI=1S/C15H9ClF2N2O/c16-11-4-2-1-3-9(11)13-10-7-8(17)5-6-12(10)19-15(21)14(18)20-13/h1-7,14H,(H,19,21) |
| InChIKey | OKXVLIUXLUDLCV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.70 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|