About 4-[2-(dimethylamino)ethyl]-1,3-dimethylpyrazolo[5,4-c]isoquinolin-5-one
4-[2-(dimethylamino)ethyl]-1,3-dimethylpyrazolo[5,4-c]isoquinolin-5-one (PubChem CID 23332760) has the molecular formula C16H20N4O
and a molecular weight of 284.36 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethyl]-1,3-dimethylpyrazolo[5,4-c]isoquinolin-5-one.
Molecular Properties
| Compound Name | 4-[2-(dimethylamino)ethyl]-1,3-dimethylpyrazolo[5,4-c]isoquinolin-5-one |
| PubChem CID | 23332760 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 4-[2-(dimethylamino)ethyl]-1,3-dimethylpyrazolo[5,4-c]isoquinolin-5-one |
| SMILES | Cc1nn(C)c2c1c1ccccc1c(=O)n2CCN(C)C |
| InChI | InChI=1S/C16H20N4O/c1-11-14-12-7-5-6-8-13(12)16(21)20(10-9-18(2)3)15(14)19(4)17-11/h5-8H,9-10H2,1-4H3 |
| InChIKey | KYAZNVYPITXOTO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 43.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2-(dimethylamino)ethyl]-1,3-dimethylpyrazolo[5,4-c]isoquinolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(dimethylamino)ethyl]-1,3-dimethylpyrazolo[5,4-c]isoquinolin-5-one?
The IUPAC name of 4-[2-(dimethylamino)ethyl]-1,3-dimethylpyrazolo[5,4-c]isoquinolin-5-one (CID 23332760) is 4-[2-(dimethylamino)ethyl]-1,3-dimethylpyrazolo[5,4-c]isoquinolin-5-one.
What is the SMILES notation for 4-[2-(dimethylamino)ethyl]-1,3-dimethylpyrazolo[5,4-c]isoquinolin-5-one?
The canonical SMILES for 4-[2-(dimethylamino)ethyl]-1,3-dimethylpyrazolo[5,4-c]isoquinolin-5-one is Cc1nn(C)c2c1c1ccccc1c(=O)n2CCN(C)C.
What is the InChIKey of 4-[2-(dimethylamino)ethyl]-1,3-dimethylpyrazolo[5,4-c]isoquinolin-5-one?
The InChIKey is KYAZNVYPITXOTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N4O/c1-11-14-12-7-5-6-8-13(12)16(21)20(10-9-18(2)3)15(14)19(4)17-11/h5-8H,9-10H2,1-4H3.
What are the key properties of 4-[2-(dimethylamino)ethyl]-1,3-dimethylpyrazolo[5,4-c]isoquinolin-5-one?
4-[2-(dimethylamino)ethyl]-1,3-dimethylpyrazolo[5,4-c]isoquinolin-5-one has a molecular weight of 284.36 g/mol, XLogP of 1.76, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(dimethylamino)ethyl]-1,3-dimethylpyrazolo[5,4-c]isoquinolin-5-one is sourced from PubChem (CID 23332760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).