About 1-oxo-N-(2H-tetrazol-5-yl)pyrimido[6,1-b][1,3]benzothiazole-4-carboxamide
1-oxo-N-(2H-tetrazol-5-yl)pyrimido[6,1-b][1,3]benzothiazole-4-carboxamide (PubChem CID 23332794) has the molecular formula C12H7N7O2S
and a molecular weight of 313.30 g/mol. Its IUPAC name is 1-oxo-N-(2H-tetrazol-5-yl)pyrimido[6,1-b][1,3]benzothiazole-4-carboxamide.
Molecular Properties
| Compound Name | 1-oxo-N-(2H-tetrazol-5-yl)pyrimido[6,1-b][1,3]benzothiazole-4-carboxamide |
| PubChem CID | 23332794 |
| Molecular Formula | C12H7N7O2S |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 1-oxo-N-(2H-tetrazol-5-yl)pyrimido[6,1-b][1,3]benzothiazole-4-carboxamide |
| SMILES | O=C(Nc1nn[nH]n1)c1cnc(=O)n2c1sc1ccccc12 |
| InChI | InChI=1S/C12H7N7O2S/c20-9(14-11-15-17-18-16-11)6-5-13-12(21)19-7-3-1-2-4-8(7)22-10(6)19/h1-5H,(H2,14,15,16,17,18,20) |
| InChIKey | RWRREZUOSRSYRQ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 117.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 1-oxo-N-(2H-tetrazol-5-yl)pyrimido[6,1-b][1,3]benzothiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxo-N-(2H-tetrazol-5-yl)pyrimido[6,1-b][1,3]benzothiazole-4-carboxamide?
The IUPAC name of 1-oxo-N-(2H-tetrazol-5-yl)pyrimido[6,1-b][1,3]benzothiazole-4-carboxamide (CID 23332794) is 1-oxo-N-(2H-tetrazol-5-yl)pyrimido[6,1-b][1,3]benzothiazole-4-carboxamide.
What is the SMILES notation for 1-oxo-N-(2H-tetrazol-5-yl)pyrimido[6,1-b][1,3]benzothiazole-4-carboxamide?
The canonical SMILES for 1-oxo-N-(2H-tetrazol-5-yl)pyrimido[6,1-b][1,3]benzothiazole-4-carboxamide is O=C(Nc1nn[nH]n1)c1cnc(=O)n2c1sc1ccccc12.
What is the InChIKey of 1-oxo-N-(2H-tetrazol-5-yl)pyrimido[6,1-b][1,3]benzothiazole-4-carboxamide?
The InChIKey is RWRREZUOSRSYRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7N7O2S/c20-9(14-11-15-17-18-16-11)6-5-13-12(21)19-7-3-1-2-4-8(7)22-10(6)19/h1-5H,(H2,14,15,16,17,18,20).
What are the key properties of 1-oxo-N-(2H-tetrazol-5-yl)pyrimido[6,1-b][1,3]benzothiazole-4-carboxamide?
1-oxo-N-(2H-tetrazol-5-yl)pyrimido[6,1-b][1,3]benzothiazole-4-carboxamide has a molecular weight of 313.30 g/mol, XLogP of 0.67, 2 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxo-N-(2H-tetrazol-5-yl)pyrimido[6,1-b][1,3]benzothiazole-4-carboxamide is sourced from PubChem (CID 23332794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).