C20H24N2O — CID 23333472
4-(2,2-dimethyl-1-oxido-5-phenyl-3,4-dihydropyrrol-1-ium-3-yl)-N,N-dimethylaniline (PubChem CID 23333472) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is 4-(2,2-dimethyl-1-oxido-5-phenyl-3,4-dihydropyrrol-1-ium-3-yl)-N,N-dimethylaniline.
| Compound Name | 4-(2,2-dimethyl-1-oxido-5-phenyl-3,4-dihydropyrrol-1-ium-3-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 23333472 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 4-(2,2-dimethyl-1-oxido-5-phenyl-3,4-dihydropyrrol-1-ium-3-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C2CC(c3ccccc3)=[N+]([O-])C2(C)C)cc1 |
| InChI | InChI=1S/C20H24N2O/c1-20(2)18(15-10-12-17(13-11-15)21(3)4)14-19(22(20)23)16-8-6-5-7-9-16/h5-13,18H,14H2,1-4H3 |
| InChIKey | PVFZEEVDTPRFHF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|