C13H15F6NO3S — CID 23333502
N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dimethylphenyl]ethanesulfonamide (PubChem CID 23333502) has the molecular formula C13H15F6NO3S and a molecular weight of 379.32 g/mol. Its IUPAC name is N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dimethylphenyl]ethanesulfonamide.
| Compound Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dimethylphenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 23333502 |
| Molecular Formula | C13H15F6NO3S |
| Molecular Weight | 379.32 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dimethylphenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1c(C)cc(C(O)(C(F)(F)F)C(F)(F)F)cc1C |
| InChI | InChI=1S/C13H15F6NO3S/c1-4-24(22,23)20-10-7(2)5-9(6-8(10)3)11(21,12(14,15)16)13(17,18)19/h5-6,20-21H,4H2,1-3H3 |
| InChIKey | KGRGDEOOTLYRNZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |