C11H10Cl3NO2S — CID 23333665
4,5,5-trichloro-2-(4-methoxyphenyl)-4-methyl-1,2-thiazolidin-3-one (PubChem CID 23333665) has the molecular formula C11H10Cl3NO2S and a molecular weight of 326.63 g/mol. Its IUPAC name is 4,5,5-trichloro-2-(4-methoxyphenyl)-4-methyl-1,2-thiazolidin-3-one.
| Compound Name | 4,5,5-trichloro-2-(4-methoxyphenyl)-4-methyl-1,2-thiazolidin-3-one |
|---|---|
| PubChem CID | 23333665 |
| Molecular Formula | C11H10Cl3NO2S |
| Molecular Weight | 326.63 g/mol |
| Exact Mass | 324.95 |
| IUPAC Name | 4,5,5-trichloro-2-(4-methoxyphenyl)-4-methyl-1,2-thiazolidin-3-one |
| SMILES | COc1ccc(N2SC(Cl)(Cl)C(C)(Cl)C2=O)cc1 |
| InChI | InChI=1S/C11H10Cl3NO2S/c1-10(12)9(16)15(18-11(10,13)14)7-3-5-8(17-2)6-4-7/h3-6H,1-2H3 |
| InChIKey | GCWLMZSFLQZQDT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.63 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|