C26H37NO3 — CID 23334069
4-[3-(dibutylamino)propoxy]-3-phenyl-5,6,7,8-tetrahydrochromen-2-one (PubChem CID 23334069) has the molecular formula C26H37NO3 and a molecular weight of 411.59 g/mol. Its IUPAC name is 4-[3-(dibutylamino)propoxy]-3-phenyl-5,6,7,8-tetrahydrochromen-2-one.
| Compound Name | 4-[3-(dibutylamino)propoxy]-3-phenyl-5,6,7,8-tetrahydrochromen-2-one |
|---|---|
| PubChem CID | 23334069 |
| Molecular Formula | C26H37NO3 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | 4-[3-(dibutylamino)propoxy]-3-phenyl-5,6,7,8-tetrahydrochromen-2-one |
| SMILES | CCCCN(CCCC)CCCOc1c2c(oc(=O)c1-c1ccccc1)CCCC2 |
| InChI | InChI=1S/C26H37NO3/c1-3-5-17-27(18-6-4-2)19-12-20-29-25-22-15-10-11-16-23(22)30-26(28)24(25)21-13-8-7-9-14-21/h7-9,13-14H,3-6,10-12,15-20H2,1-2H3 |
| InChIKey | ZWWLVZKDKWHGIW-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|