About [5-(5,5,5-trifluoropentoxy)-2-pyridinyl]methanol
[5-(5,5,5-trifluoropentoxy)-2-pyridinyl]methanol (PubChem CID 23335292) has the molecular formula C11H14F3NO2
and a molecular weight of 249.23 g/mol. Its IUPAC name is [5-(5,5,5-trifluoropentoxy)-2-pyridinyl]methanol.
Molecular Properties
| Compound Name | [5-(5,5,5-trifluoropentoxy)-2-pyridinyl]methanol |
| PubChem CID | 23335292 |
| Molecular Formula | C11H14F3NO2 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | [5-(5,5,5-trifluoropentoxy)-2-pyridinyl]methanol |
| SMILES | OCc1ccc(OCCCCC(F)(F)F)cn1 |
| InChI | InChI=1S/C11H14F3NO2/c12-11(13,14)5-1-2-6-17-10-4-3-9(8-16)15-7-10/h3-4,7,16H,1-2,5-6,8H2 |
| InChIKey | VZNBOUOHGXQJTK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [5-(5,5,5-trifluoropentoxy)-2-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(5,5,5-trifluoropentoxy)-2-pyridinyl]methanol?
The IUPAC name of [5-(5,5,5-trifluoropentoxy)-2-pyridinyl]methanol (CID 23335292) is [5-(5,5,5-trifluoropentoxy)-2-pyridinyl]methanol.
What is the SMILES notation for [5-(5,5,5-trifluoropentoxy)-2-pyridinyl]methanol?
The canonical SMILES for [5-(5,5,5-trifluoropentoxy)-2-pyridinyl]methanol is OCc1ccc(OCCCCC(F)(F)F)cn1.
What is the InChIKey of [5-(5,5,5-trifluoropentoxy)-2-pyridinyl]methanol?
The InChIKey is VZNBOUOHGXQJTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F3NO2/c12-11(13,14)5-1-2-6-17-10-4-3-9(8-16)15-7-10/h3-4,7,16H,1-2,5-6,8H2.
What are the key properties of [5-(5,5,5-trifluoropentoxy)-2-pyridinyl]methanol?
[5-(5,5,5-trifluoropentoxy)-2-pyridinyl]methanol has a molecular weight of 249.23 g/mol, XLogP of 2.69, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(5,5,5-trifluoropentoxy)-2-pyridinyl]methanol is sourced from PubChem (CID 23335292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).