C14H11Cl3N4 — CID 23335315
5,6-dimethyl-7-(2,4,5-trichlorophenyl)pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 23335315) has the molecular formula C14H11Cl3N4 and a molecular weight of 341.63 g/mol. Its IUPAC name is 5,6-dimethyl-7-(2,4,5-trichlorophenyl)pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 5,6-dimethyl-7-(2,4,5-trichlorophenyl)pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 23335315 |
| Molecular Formula | C14H11Cl3N4 |
| Molecular Weight | 341.63 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | 5,6-dimethyl-7-(2,4,5-trichlorophenyl)pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1c(C)n(-c2cc(Cl)c(Cl)cc2Cl)c2ncnc(N)c12 |
| InChI | InChI=1S/C14H11Cl3N4/c1-6-7(2)21(14-12(6)13(18)19-5-20-14)11-4-9(16)8(15)3-10(11)17/h3-5H,1-2H3,(H2,18,19,20) |
| InChIKey | MMSMWSXPLBEHDG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.63 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|