C11H12N2O — CID 23335375
5,6,7-trimethyl-1H-1,8-naphthyridin-2-one (PubChem CID 23335375) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 5,6,7-trimethyl-1H-1,8-naphthyridin-2-one.
| Compound Name | 5,6,7-trimethyl-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 23335375 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 5,6,7-trimethyl-1H-1,8-naphthyridin-2-one |
| SMILES | Cc1nc2[nH]c(=O)ccc2c(C)c1C |
| InChI | InChI=1S/C11H12N2O/c1-6-7(2)9-4-5-10(14)13-11(9)12-8(6)3/h4-5H,1-3H3,(H,12,13,14) |
| InChIKey | NWBIBHUGHPMSCI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |