About 1-(4-aminobutyl)-5,7-dimethyl-1,8-naphthyridin-2-one;hydrochloride
1-(4-aminobutyl)-5,7-dimethyl-1,8-naphthyridin-2-one;hydrochloride (PubChem CID 23335414) has the molecular formula C14H20ClN3O
and a molecular weight of 281.79 g/mol. Its IUPAC name is 1-(4-aminobutyl)-5,7-dimethyl-1,8-naphthyridin-2-one;hydrochloride.
Molecular Properties
| Compound Name | 1-(4-aminobutyl)-5,7-dimethyl-1,8-naphthyridin-2-one;hydrochloride |
| PubChem CID | 23335414 |
| Molecular Formula | C14H20ClN3O |
| Molecular Weight | 281.79 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 1-(4-aminobutyl)-5,7-dimethyl-1,8-naphthyridin-2-one;hydrochloride |
| SMILES | Cc1cc(C)c2ccc(=O)n(CCCCN)c2n1.Cl |
| InChI | InChI=1S/C14H19N3O.ClH/c1-10-9-11(2)16-14-12(10)5-6-13(18)17(14)8-4-3-7-15;/h5-6,9H,3-4,7-8,15H2,1-2H3;1H |
| InChIKey | QZFHXDWLXJZJDJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.79 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-aminobutyl)-5,7-dimethyl-1,8-naphthyridin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-aminobutyl)-5,7-dimethyl-1,8-naphthyridin-2-one;hydrochloride?
The IUPAC name of 1-(4-aminobutyl)-5,7-dimethyl-1,8-naphthyridin-2-one;hydrochloride (CID 23335414) is 1-(4-aminobutyl)-5,7-dimethyl-1,8-naphthyridin-2-one;hydrochloride.
What is the SMILES notation for 1-(4-aminobutyl)-5,7-dimethyl-1,8-naphthyridin-2-one;hydrochloride?
The canonical SMILES for 1-(4-aminobutyl)-5,7-dimethyl-1,8-naphthyridin-2-one;hydrochloride is Cc1cc(C)c2ccc(=O)n(CCCCN)c2n1.Cl.
What is the InChIKey of 1-(4-aminobutyl)-5,7-dimethyl-1,8-naphthyridin-2-one;hydrochloride?
The InChIKey is QZFHXDWLXJZJDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O.ClH/c1-10-9-11(2)16-14-12(10)5-6-13(18)17(14)8-4-3-7-15;/h5-6,9H,3-4,7-8,15H2,1-2H3;1H.
What are the key properties of 1-(4-aminobutyl)-5,7-dimethyl-1,8-naphthyridin-2-one;hydrochloride?
1-(4-aminobutyl)-5,7-dimethyl-1,8-naphthyridin-2-one;hydrochloride has a molecular weight of 281.79 g/mol, XLogP of 2.17, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-aminobutyl)-5,7-dimethyl-1,8-naphthyridin-2-one;hydrochloride is sourced from PubChem (CID 23335414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).