About [(E)-N'-phenylsulfanylcarbamimidoyl] carbamate
[(E)-N'-phenylsulfanylcarbamimidoyl] carbamate (PubChem CID 23335468) has the molecular formula C8H9N3O2S
and a molecular weight of 211.25 g/mol. Its IUPAC name is [(E)-N'-phenylsulfanylcarbamimidoyl] carbamate.
Molecular Properties
| Compound Name | [(E)-N'-phenylsulfanylcarbamimidoyl] carbamate |
| PubChem CID | 23335468 |
| Molecular Formula | C8H9N3O2S |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | [(E)-N'-phenylsulfanylcarbamimidoyl] carbamate |
| SMILES | NC(=O)O/C(N)=N/Sc1ccccc1 |
| InChI | InChI=1S/C8H9N3O2S/c9-7(13-8(10)12)11-14-6-4-2-1-3-5-6/h1-5H,(H2,9,11)(H2,10,12) |
| InChIKey | BUKLHHMLQWAXEI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-N'-phenylsulfanylcarbamimidoyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-N'-phenylsulfanylcarbamimidoyl] carbamate?
The IUPAC name of [(E)-N'-phenylsulfanylcarbamimidoyl] carbamate (CID 23335468) is [(E)-N'-phenylsulfanylcarbamimidoyl] carbamate.
What is the SMILES notation for [(E)-N'-phenylsulfanylcarbamimidoyl] carbamate?
The canonical SMILES for [(E)-N'-phenylsulfanylcarbamimidoyl] carbamate is NC(=O)O/C(N)=N/Sc1ccccc1.
What is the InChIKey of [(E)-N'-phenylsulfanylcarbamimidoyl] carbamate?
The InChIKey is BUKLHHMLQWAXEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O2S/c9-7(13-8(10)12)11-14-6-4-2-1-3-5-6/h1-5H,(H2,9,11)(H2,10,12).
What are the key properties of [(E)-N'-phenylsulfanylcarbamimidoyl] carbamate?
[(E)-N'-phenylsulfanylcarbamimidoyl] carbamate has a molecular weight of 211.25 g/mol, XLogP of 1.10, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-N'-phenylsulfanylcarbamimidoyl] carbamate is sourced from PubChem (CID 23335468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).