About cyclohexa-1,3-diene-1-carbohydrazide
cyclohexa-1,3-diene-1-carbohydrazide (PubChem CID 23335485) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is cyclohexa-1,3-diene-1-carbohydrazide.
Molecular Properties
| Compound Name | cyclohexa-1,3-diene-1-carbohydrazide |
| PubChem CID | 23335485 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | cyclohexa-1,3-diene-1-carbohydrazide |
| SMILES | NNC(=O)C1=CC=CCC1 |
| InChI | InChI=1S/C7H10N2O/c8-9-7(10)6-4-2-1-3-5-6/h1-2,4H,3,5,8H2,(H,9,10) |
| InChIKey | GPIWLHPJIHDBTL-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cyclohexa-1,3-diene-1-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-1,3-diene-1-carbohydrazide?
The IUPAC name of cyclohexa-1,3-diene-1-carbohydrazide (CID 23335485) is cyclohexa-1,3-diene-1-carbohydrazide.
What is the SMILES notation for cyclohexa-1,3-diene-1-carbohydrazide?
The canonical SMILES for cyclohexa-1,3-diene-1-carbohydrazide is NNC(=O)C1=CC=CCC1.
What is the InChIKey of cyclohexa-1,3-diene-1-carbohydrazide?
The InChIKey is GPIWLHPJIHDBTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O/c8-9-7(10)6-4-2-1-3-5-6/h1-2,4H,3,5,8H2,(H,9,10).
What are the key properties of cyclohexa-1,3-diene-1-carbohydrazide?
cyclohexa-1,3-diene-1-carbohydrazide has a molecular weight of 138.17 g/mol, XLogP of 0.25, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-1,3-diene-1-carbohydrazide is sourced from PubChem (CID 23335485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).