About 2,4-diaminobenzene-1,3-dithiol
2,4-diaminobenzene-1,3-dithiol (PubChem CID 23335700) has the molecular formula C6H8N2S2
and a molecular weight of 172.28 g/mol. Its IUPAC name is 2,4-diaminobenzene-1,3-dithiol.
Molecular Properties
| Compound Name | 2,4-diaminobenzene-1,3-dithiol |
| PubChem CID | 23335700 |
| Molecular Formula | C6H8N2S2 |
| Molecular Weight | 172.28 g/mol |
| Exact Mass | 172.01 |
| IUPAC Name | 2,4-diaminobenzene-1,3-dithiol |
| SMILES | Nc1ccc(S)c(N)c1S |
| InChI | InChI=1S/C6H8N2S2/c7-3-1-2-4(9)5(8)6(3)10/h1-2,9-10H,7-8H2 |
| InChIKey | MGPZKVZQZQIWSV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diaminobenzene-1,3-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diaminobenzene-1,3-dithiol?
The IUPAC name of 2,4-diaminobenzene-1,3-dithiol (CID 23335700) is 2,4-diaminobenzene-1,3-dithiol.
What is the SMILES notation for 2,4-diaminobenzene-1,3-dithiol?
The canonical SMILES for 2,4-diaminobenzene-1,3-dithiol is Nc1ccc(S)c(N)c1S.
What is the InChIKey of 2,4-diaminobenzene-1,3-dithiol?
The InChIKey is MGPZKVZQZQIWSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2S2/c7-3-1-2-4(9)5(8)6(3)10/h1-2,9-10H,7-8H2.
What are the key properties of 2,4-diaminobenzene-1,3-dithiol?
2,4-diaminobenzene-1,3-dithiol has a molecular weight of 172.28 g/mol, XLogP of 1.43, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diaminobenzene-1,3-dithiol is sourced from PubChem (CID 23335700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).