About S-[3-(2-oxo-1,3-benzothiazol-3-yl)propyl] N,N-diethylcarbamothioate
S-[3-(2-oxo-1,3-benzothiazol-3-yl)propyl] N,N-diethylcarbamothioate (PubChem CID 23335991) has the molecular formula C15H20N2O2S2
and a molecular weight of 324.47 g/mol. Its IUPAC name is S-[3-(2-oxo-1,3-benzothiazol-3-yl)propyl] N,N-diethylcarbamothioate.
Molecular Properties
| Compound Name | S-[3-(2-oxo-1,3-benzothiazol-3-yl)propyl] N,N-diethylcarbamothioate |
| PubChem CID | 23335991 |
| Molecular Formula | C15H20N2O2S2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | S-[3-(2-oxo-1,3-benzothiazol-3-yl)propyl] N,N-diethylcarbamothioate |
| SMILES | CCN(CC)C(=O)SCCCn1c(=O)sc2ccccc21 |
| InChI | InChI=1S/C15H20N2O2S2/c1-3-16(4-2)14(18)20-11-7-10-17-12-8-5-6-9-13(12)21-15(17)19/h5-6,8-9H,3-4,7,10-11H2,1-2H3 |
| InChIKey | PYGJPRNYEIWSJT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[3-(2-oxo-1,3-benzothiazol-3-yl)propyl] N,N-diethylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[3-(2-oxo-1,3-benzothiazol-3-yl)propyl] N,N-diethylcarbamothioate?
The IUPAC name of S-[3-(2-oxo-1,3-benzothiazol-3-yl)propyl] N,N-diethylcarbamothioate (CID 23335991) is S-[3-(2-oxo-1,3-benzothiazol-3-yl)propyl] N,N-diethylcarbamothioate.
What is the SMILES notation for S-[3-(2-oxo-1,3-benzothiazol-3-yl)propyl] N,N-diethylcarbamothioate?
The canonical SMILES for S-[3-(2-oxo-1,3-benzothiazol-3-yl)propyl] N,N-diethylcarbamothioate is CCN(CC)C(=O)SCCCn1c(=O)sc2ccccc21.
What is the InChIKey of S-[3-(2-oxo-1,3-benzothiazol-3-yl)propyl] N,N-diethylcarbamothioate?
The InChIKey is PYGJPRNYEIWSJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O2S2/c1-3-16(4-2)14(18)20-11-7-10-17-12-8-5-6-9-13(12)21-15(17)19/h5-6,8-9H,3-4,7,10-11H2,1-2H3.
What are the key properties of S-[3-(2-oxo-1,3-benzothiazol-3-yl)propyl] N,N-diethylcarbamothioate?
S-[3-(2-oxo-1,3-benzothiazol-3-yl)propyl] N,N-diethylcarbamothioate has a molecular weight of 324.47 g/mol, XLogP of 3.65, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-[3-(2-oxo-1,3-benzothiazol-3-yl)propyl] N,N-diethylcarbamothioate is sourced from PubChem (CID 23335991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).