C12H14N3O3- — CID 23336078
N-ethyl-N-[(4-methyl-1H-benzimidazol-2-yl)methoxy]carbamate (PubChem CID 23336078) has the molecular formula C12H14N3O3- and a molecular weight of 248.26 g/mol. Its IUPAC name is N-ethyl-N-[(4-methyl-1H-benzimidazol-2-yl)methoxy]carbamate.
| Compound Name | N-ethyl-N-[(4-methyl-1H-benzimidazol-2-yl)methoxy]carbamate |
|---|---|
| PubChem CID | 23336078 |
| Molecular Formula | C12H14N3O3- |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | N-ethyl-N-[(4-methyl-1H-benzimidazol-2-yl)methoxy]carbamate |
| SMILES | CCN(OCc1nc2c(C)cccc2[nH]1)C(=O)[O-] |
| InChI | InChI=1S/C12H15N3O3/c1-3-15(12(16)17)18-7-10-13-9-6-4-5-8(2)11(9)14-10/h4-6H,3,7H2,1-2H3,(H,13,14)(H,16,17)/p-1 |
| InChIKey | HQQHSARIXAMUAE-UHFFFAOYSA-M |
| XLogP | 0.97 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|