C9H6Cl8OSi — CID 23336289
trichloro-[3-(2,3,4,5,6-pentachlorophenoxy)propyl]silane (PubChem CID 23336289) has the molecular formula C9H6Cl8OSi and a molecular weight of 441.86 g/mol. Its IUPAC name is trichloro-[3-(2,3,4,5,6-pentachlorophenoxy)propyl]silane.
| Compound Name | trichloro-[3-(2,3,4,5,6-pentachlorophenoxy)propyl]silane |
|---|---|
| PubChem CID | 23336289 |
| Molecular Formula | C9H6Cl8OSi |
| Molecular Weight | 441.86 g/mol |
| Exact Mass | 437.77 |
| IUPAC Name | trichloro-[3-(2,3,4,5,6-pentachlorophenoxy)propyl]silane |
| SMILES | Clc1c(Cl)c(Cl)c(OCCC[Si](Cl)(Cl)Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C9H6Cl8OSi/c10-4-5(11)7(13)9(8(14)6(4)12)18-2-1-3-19(15,16)17/h1-3H2 |
| InChIKey | BGLYNTKAVFSCJW-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.86 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|