C9H12ClNS — CID 23336523
1,2,3,4-tetrahydroisoquinoline-7-thiol;hydrochloride (PubChem CID 23336523) has the molecular formula C9H12ClNS and a molecular weight of 201.72 g/mol. Its IUPAC name is 1,2,3,4-tetrahydroisoquinoline-7-thiol;hydrochloride.
| Compound Name | 1,2,3,4-tetrahydroisoquinoline-7-thiol;hydrochloride |
|---|---|
| PubChem CID | 23336523 |
| Molecular Formula | C9H12ClNS |
| Molecular Weight | 201.72 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 1,2,3,4-tetrahydroisoquinoline-7-thiol;hydrochloride |
| SMILES | Cl.Sc1ccc2c(c1)CNCC2 |
| InChI | InChI=1S/C9H11NS.ClH/c11-9-2-1-7-3-4-10-6-8(7)5-9;/h1-2,5,10-11H,3-4,6H2;1H |
| InChIKey | SYIFADWEEZRDEH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.72 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|