C29H34BrNO4 — CID 23336631
(1,1-dimethylpyrrolidin-1-ium-3-yl) 2,2-diphenyl-2-(2-phenylmethoxyethoxy)acetate bromide (PubChem CID 23336631) has the molecular formula C29H34BrNO4 and a molecular weight of 540.50 g/mol. Its IUPAC name is (1,1-dimethylpyrrolidin-1-ium-3-yl) 2,2-diphenyl-2-(2-phenylmethoxyethoxy)acetate bromide.
| Compound Name | (1,1-dimethylpyrrolidin-1-ium-3-yl) 2,2-diphenyl-2-(2-phenylmethoxyethoxy)acetate bromide |
|---|---|
| PubChem CID | 23336631 |
| Molecular Formula | C29H34BrNO4 |
| Molecular Weight | 540.50 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | (1,1-dimethylpyrrolidin-1-ium-3-yl) 2,2-diphenyl-2-(2-phenylmethoxyethoxy)acetate bromide |
| SMILES | C[N+]1(C)CCC(OC(=O)C(OCCOCc2ccccc2)(c2ccccc2)c2ccccc2)C1.[Br-] |
| InChI | InChI=1S/C29H34NO4.BrH/c1-30(2)19-18-27(22-30)34-28(31)29(25-14-8-4-9-15-25,26-16-10-5-11-17-26)33-21-20-32-23-24-12-6-3-7-13-24;/h3-17,27H,18-23H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | GCQJZTSKZXMCSV-UHFFFAOYSA-M |
| XLogP | 1.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.50 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|