C5H6Br6 — CID 23336945
1,1,2,2,4,5-hexabromopentane (PubChem CID 23336945) has the molecular formula C5H6Br6 and a molecular weight of 545.53 g/mol. Its IUPAC name is 1,1,2,2,4,5-hexabromopentane.
| Compound Name | 1,1,2,2,4,5-hexabromopentane |
|---|---|
| PubChem CID | 23336945 |
| Molecular Formula | C5H6Br6 |
| Molecular Weight | 545.53 g/mol |
| Exact Mass | 539.56 |
| IUPAC Name | 1,1,2,2,4,5-hexabromopentane |
| SMILES | BrCC(Br)CC(Br)(Br)C(Br)Br |
| InChI | InChI=1S/C5H6Br6/c6-2-3(7)1-5(10,11)4(8)9/h3-4H,1-2H2 |
| InChIKey | CWNYDZTWJWVVMT-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.53 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|