C17H20N4O5 — CID 23337026
1,9,9-trimethyl-5-(3-nitrophenyl)-6-oxido-10-oxa-3,4-diaza-6-azoniatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene;hydrate (PubChem CID 23337026) has the molecular formula C17H20N4O5 and a molecular weight of 360.37 g/mol. Its IUPAC name is 1,9,9-trimethyl-5-(3-nitrophenyl)-6-oxido-10-oxa-3,4-diaza-6-azoniatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene;hydrate.
| Compound Name | 1,9,9-trimethyl-5-(3-nitrophenyl)-6-oxido-10-oxa-3,4-diaza-6-azoniatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene;hydrate |
|---|---|
| PubChem CID | 23337026 |
| Molecular Formula | C17H20N4O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 1,9,9-trimethyl-5-(3-nitrophenyl)-6-oxido-10-oxa-3,4-diaza-6-azoniatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene;hydrate |
| SMILES | CC12CCC(c3c1nnc(-c1cccc([N+](=O)[O-])c1)[n+]3[O-])C(C)(C)O2.O |
| InChI | InChI=1S/C17H18N4O4.H2O/c1-16(2)12-7-8-17(3,25-16)14-13(12)20(22)15(19-18-14)10-5-4-6-11(9-10)21(23)24;/h4-6,9,12H,7-8H2,1-3H3;1H2 |
| InChIKey | YEGYBYPKILSAES-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 136.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|