About 2H-pyrrolo[3,2-b]quinoxaline
2H-pyrrolo[3,2-b]quinoxaline (PubChem CID 23337252) has the molecular formula C10H7N3
and a molecular weight of 169.19 g/mol. Its IUPAC name is 2H-pyrrolo[3,2-b]quinoxaline.
Molecular Properties
| Compound Name | 2H-pyrrolo[3,2-b]quinoxaline |
| PubChem CID | 23337252 |
| Molecular Formula | C10H7N3 |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 2H-pyrrolo[3,2-b]quinoxaline |
| SMILES | C1=c2nc3ccccc3nc2=NC1 |
| InChI | InChI=1S/C10H7N3/c1-2-4-8-7(3-1)12-9-5-6-11-10(9)13-8/h1-5H,6H2 |
| InChIKey | MWRHWPHADLTIBW-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2H-pyrrolo[3,2-b]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-pyrrolo[3,2-b]quinoxaline?
The IUPAC name of 2H-pyrrolo[3,2-b]quinoxaline (CID 23337252) is 2H-pyrrolo[3,2-b]quinoxaline.
What is the SMILES notation for 2H-pyrrolo[3,2-b]quinoxaline?
The canonical SMILES for 2H-pyrrolo[3,2-b]quinoxaline is C1=c2nc3ccccc3nc2=NC1.
What is the InChIKey of 2H-pyrrolo[3,2-b]quinoxaline?
The InChIKey is MWRHWPHADLTIBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3/c1-2-4-8-7(3-1)12-9-5-6-11-10(9)13-8/h1-5H,6H2.
What are the key properties of 2H-pyrrolo[3,2-b]quinoxaline?
2H-pyrrolo[3,2-b]quinoxaline has a molecular weight of 169.19 g/mol, XLogP of 0.04, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-pyrrolo[3,2-b]quinoxaline is sourced from PubChem (CID 23337252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).