C16H24F6N4O8S2 — CID 23337382
N,N'-bis(2-morpholin-2-ylethyl)-N,N'-bis(trifluoromethylsulfonyl)oxamide (PubChem CID 23337382) has the molecular formula C16H24F6N4O8S2 and a molecular weight of 578.51 g/mol. Its IUPAC name is N,N'-bis(2-morpholin-2-ylethyl)-N,N'-bis(trifluoromethylsulfonyl)oxamide.
| Compound Name | N,N'-bis(2-morpholin-2-ylethyl)-N,N'-bis(trifluoromethylsulfonyl)oxamide |
|---|---|
| PubChem CID | 23337382 |
| Molecular Formula | C16H24F6N4O8S2 |
| Molecular Weight | 578.51 g/mol |
| Exact Mass | 578.09 |
| IUPAC Name | N,N'-bis(2-morpholin-2-ylethyl)-N,N'-bis(trifluoromethylsulfonyl)oxamide |
| SMILES | O=C(C(=O)N(CCC1CNCCO1)S(=O)(=O)C(F)(F)F)N(CCC1CNCCO1)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H24F6N4O8S2/c17-15(18,19)35(29,30)25(5-1-11-9-23-3-7-33-11)13(27)14(28)26(36(31,32)16(20,21)22)6-2-12-10-24-4-8-34-12/h11-12,23-24H,1-10H2 |
| InChIKey | UJLQHXBOFVPYMQ-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.51 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|