C13H19NO2 — CID 23337631
2-butyl-4-methyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione (PubChem CID 23337631) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-butyl-4-methyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-butyl-4-methyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 23337631 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2-butyl-4-methyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CCCCN1C(=O)C2C=CCC(C)C2C1=O |
| InChI | InChI=1S/C13H19NO2/c1-3-4-8-14-12(15)10-7-5-6-9(2)11(10)13(14)16/h5,7,9-11H,3-4,6,8H2,1-2H3 |
| InChIKey | AGMGRKTVLNLWJM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|