C16H24ClN3O2S — CID 23337790
2-(6-chloro-1,1-dioxospiro[2,4-dihydro-1λ6,2,4-benzothiadiazine-3,4'-cyclohexane]-1'-yl)-N,N-dimethylethanamine (PubChem CID 23337790) has the molecular formula C16H24ClN3O2S and a molecular weight of 357.91 g/mol. Its IUPAC name is 2-(6-chloro-1,1-dioxospiro[2,4-dihydro-1λ6,2,4-benzothiadiazine-3,4'-cyclohexane]-1'-yl)-N,N-dimethylethanamine.
| Compound Name | 2-(6-chloro-1,1-dioxospiro[2,4-dihydro-1λ6,2,4-benzothiadiazine-3,4'-cyclohexane]-1'-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 23337790 |
| Molecular Formula | C16H24ClN3O2S |
| Molecular Weight | 357.91 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 2-(6-chloro-1,1-dioxospiro[2,4-dihydro-1λ6,2,4-benzothiadiazine-3,4'-cyclohexane]-1'-yl)-N,N-dimethylethanamine |
| SMILES | CN(C)CCC1CCC2(CC1)Nc1cc(Cl)ccc1S(=O)(=O)N2 |
| InChI | InChI=1S/C16H24ClN3O2S/c1-20(2)10-7-12-5-8-16(9-6-12)18-14-11-13(17)3-4-15(14)23(21,22)19-16/h3-4,11-12,18-19H,5-10H2,1-2H3 |
| InChIKey | IFJDVLVVDYSOET-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.91 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |