C11H11N7O2 — CID 23338132
isoindole-1,3-dione;1,3,5-triazine-2,4,6-triamine (PubChem CID 23338132) has the molecular formula C11H11N7O2 and a molecular weight of 273.26 g/mol. Its IUPAC name is isoindole-1,3-dione;1,3,5-triazine-2,4,6-triamine.
| Compound Name | isoindole-1,3-dione;1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 23338132 |
| Molecular Formula | C11H11N7O2 |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | isoindole-1,3-dione;1,3,5-triazine-2,4,6-triamine |
| SMILES | Nc1nc(N)nc(N)n1.O=C1NC(=O)c2ccccc21 |
| InChI | InChI=1S/C8H5NO2.C3H6N6/c10-7-5-3-1-2-4-6(5)8(11)9-7;4-1-7-2(5)9-3(6)8-1/h1-4H,(H,9,10,11);(H6,4,5,6,7,8,9) |
| InChIKey | YIQBUGYKMKWBHV-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 162.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|