C7H13N3O2 — CID 23338144
ethyl N-(1,4,5,6-tetrahydropyrimidin-2-yl)carbamate (PubChem CID 23338144) has the molecular formula C7H13N3O2 and a molecular weight of 171.20 g/mol. Its IUPAC name is ethyl N-(1,4,5,6-tetrahydropyrimidin-2-yl)carbamate.
| Compound Name | ethyl N-(1,4,5,6-tetrahydropyrimidin-2-yl)carbamate |
|---|---|
| PubChem CID | 23338144 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | ethyl N-(1,4,5,6-tetrahydropyrimidin-2-yl)carbamate |
| SMILES | CCOC(=O)NC1=NCCCN1 |
| InChI | InChI=1S/C7H13N3O2/c1-2-12-7(11)10-6-8-4-3-5-9-6/h2-5H2,1H3,(H2,8,9,10,11) |
| InChIKey | LSADBUSTYBNICG-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |