C9H10ClNO — CID 23338159
8-chloro-5,6,7,8-tetrahydro-1H-quinolin-2-one (PubChem CID 23338159) has the molecular formula C9H10ClNO and a molecular weight of 183.64 g/mol. Its IUPAC name is 8-chloro-5,6,7,8-tetrahydro-1H-quinolin-2-one.
| Compound Name | 8-chloro-5,6,7,8-tetrahydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 23338159 |
| Molecular Formula | C9H10ClNO |
| Molecular Weight | 183.64 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 8-chloro-5,6,7,8-tetrahydro-1H-quinolin-2-one |
| SMILES | O=c1ccc2c([nH]1)C(Cl)CCC2 |
| InChI | InChI=1S/C9H10ClNO/c10-7-3-1-2-6-4-5-8(12)11-9(6)7/h4-5,7H,1-3H2,(H,11,12) |
| InChIKey | VYFFDLGQYICPMX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.64 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|