C50H82N4O7 — CID 23338194
tris(1,2,2,6,6-pentamethylpiperidin-4-yl) 4-(5-tert-butyl-4-hydroxy-2,3-dimethylphenyl)-3-cyanobutane-1,2,3-tricarboxylate (PubChem CID 23338194) has the molecular formula C50H82N4O7 and a molecular weight of 851.23 g/mol. Its IUPAC name is tris(1,2,2,6,6-pentamethylpiperidin-4-yl) 4-(5-tert-butyl-4-hydroxy-2,3-dimethylphenyl)-3-cyanobutane-1,2,3-tricarboxylate.
| Compound Name | tris(1,2,2,6,6-pentamethylpiperidin-4-yl) 4-(5-tert-butyl-4-hydroxy-2,3-dimethylphenyl)-3-cyanobutane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 23338194 |
| Molecular Formula | C50H82N4O7 |
| Molecular Weight | 851.23 g/mol |
| Exact Mass | 850.62 |
| IUPAC Name | tris(1,2,2,6,6-pentamethylpiperidin-4-yl) 4-(5-tert-butyl-4-hydroxy-2,3-dimethylphenyl)-3-cyanobutane-1,2,3-tricarboxylate |
| SMILES | Cc1c(CC(C#N)(C(=O)OC2CC(C)(C)N(C)C(C)(C)C2)C(CC(=O)OC2CC(C)(C)N(C)C(C)(C)C2)C(=O)OC2CC(C)(C)N(C)C(C)(C)C2)cc(C(C)(C)C)c(O)c1C |
| InChI | InChI=1S/C50H82N4O7/c1-31-32(2)40(56)37(43(3,4)5)21-33(31)23-50(30-51,42(58)61-36-28-48(14,15)54(20)49(16,17)29-36)38(41(57)60-35-26-46(10,11)53(19)47(12,13)27-35)22-39(55)59-34-24-44(6,7)52(18)45(8,9)25-34/h21,34-36,38,56H,22-29H2,1-20H3 |
| InChIKey | UUOUPUBWUYRHFQ-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 132.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.23 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|