C19H30O3 — CID 23338328
1-[3-(1-ethoxyethoxy)-3-methylpent-4-en-1-ynyl]-2,6,6-trimethylcyclohex-2-en-1-ol (PubChem CID 23338328) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is 1-[3-(1-ethoxyethoxy)-3-methylpent-4-en-1-ynyl]-2,6,6-trimethylcyclohex-2-en-1-ol.
| Compound Name | 1-[3-(1-ethoxyethoxy)-3-methylpent-4-en-1-ynyl]-2,6,6-trimethylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 23338328 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 1-[3-(1-ethoxyethoxy)-3-methylpent-4-en-1-ynyl]-2,6,6-trimethylcyclohex-2-en-1-ol |
| SMILES | C=CC(C)(C#CC1(O)C(C)=CCCC1(C)C)OC(C)OCC |
| InChI | InChI=1S/C19H30O3/c1-8-18(7,22-16(4)21-9-2)13-14-19(20)15(3)11-10-12-17(19,5)6/h8,11,16,20H,1,9-10,12H2,2-7H3 |
| InChIKey | STTMCPSMECVXIC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|