About 1-(2-aminoethyl)-6-hydroxy-4,5-dimethylpyridin-2-one
1-(2-aminoethyl)-6-hydroxy-4,5-dimethylpyridin-2-one (PubChem CID 23338583) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is 1-(2-aminoethyl)-6-hydroxy-4,5-dimethylpyridin-2-one.
Molecular Properties
| Compound Name | 1-(2-aminoethyl)-6-hydroxy-4,5-dimethylpyridin-2-one |
| PubChem CID | 23338583 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 1-(2-aminoethyl)-6-hydroxy-4,5-dimethylpyridin-2-one |
| SMILES | Cc1cc(=O)n(CCN)c(O)c1C |
| InChI | InChI=1S/C9H14N2O2/c1-6-5-8(12)11(4-3-10)9(13)7(6)2/h5,13H,3-4,10H2,1-2H3 |
| InChIKey | PUBGUBMGAVJRFP-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-aminoethyl)-6-hydroxy-4,5-dimethylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-aminoethyl)-6-hydroxy-4,5-dimethylpyridin-2-one?
The IUPAC name of 1-(2-aminoethyl)-6-hydroxy-4,5-dimethylpyridin-2-one (CID 23338583) is 1-(2-aminoethyl)-6-hydroxy-4,5-dimethylpyridin-2-one.
What is the SMILES notation for 1-(2-aminoethyl)-6-hydroxy-4,5-dimethylpyridin-2-one?
The canonical SMILES for 1-(2-aminoethyl)-6-hydroxy-4,5-dimethylpyridin-2-one is Cc1cc(=O)n(CCN)c(O)c1C.
What is the InChIKey of 1-(2-aminoethyl)-6-hydroxy-4,5-dimethylpyridin-2-one?
The InChIKey is PUBGUBMGAVJRFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-6-5-8(12)11(4-3-10)9(13)7(6)2/h5,13H,3-4,10H2,1-2H3.
What are the key properties of 1-(2-aminoethyl)-6-hydroxy-4,5-dimethylpyridin-2-one?
1-(2-aminoethyl)-6-hydroxy-4,5-dimethylpyridin-2-one has a molecular weight of 182.22 g/mol, XLogP of 0.13, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-aminoethyl)-6-hydroxy-4,5-dimethylpyridin-2-one is sourced from PubChem (CID 23338583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).