About 6-hydroxy-4,5-dimethyl-1-[2-(methylamino)ethyl]pyridin-2-one
6-hydroxy-4,5-dimethyl-1-[2-(methylamino)ethyl]pyridin-2-one (PubChem CID 23338619) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is 6-hydroxy-4,5-dimethyl-1-[2-(methylamino)ethyl]pyridin-2-one.
Molecular Properties
| Compound Name | 6-hydroxy-4,5-dimethyl-1-[2-(methylamino)ethyl]pyridin-2-one |
| PubChem CID | 23338619 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 6-hydroxy-4,5-dimethyl-1-[2-(methylamino)ethyl]pyridin-2-one |
| SMILES | CNCCn1c(O)c(C)c(C)cc1=O |
| InChI | InChI=1S/C10H16N2O2/c1-7-6-9(13)12(5-4-11-3)10(14)8(7)2/h6,11,14H,4-5H2,1-3H3 |
| InChIKey | KYEJRWAVQYFTMP-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-hydroxy-4,5-dimethyl-1-[2-(methylamino)ethyl]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-4,5-dimethyl-1-[2-(methylamino)ethyl]pyridin-2-one?
The IUPAC name of 6-hydroxy-4,5-dimethyl-1-[2-(methylamino)ethyl]pyridin-2-one (CID 23338619) is 6-hydroxy-4,5-dimethyl-1-[2-(methylamino)ethyl]pyridin-2-one.
What is the SMILES notation for 6-hydroxy-4,5-dimethyl-1-[2-(methylamino)ethyl]pyridin-2-one?
The canonical SMILES for 6-hydroxy-4,5-dimethyl-1-[2-(methylamino)ethyl]pyridin-2-one is CNCCn1c(O)c(C)c(C)cc1=O.
What is the InChIKey of 6-hydroxy-4,5-dimethyl-1-[2-(methylamino)ethyl]pyridin-2-one?
The InChIKey is KYEJRWAVQYFTMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2/c1-7-6-9(13)12(5-4-11-3)10(14)8(7)2/h6,11,14H,4-5H2,1-3H3.
What are the key properties of 6-hydroxy-4,5-dimethyl-1-[2-(methylamino)ethyl]pyridin-2-one?
6-hydroxy-4,5-dimethyl-1-[2-(methylamino)ethyl]pyridin-2-one has a molecular weight of 196.25 g/mol, XLogP of 0.39, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-4,5-dimethyl-1-[2-(methylamino)ethyl]pyridin-2-one is sourced from PubChem (CID 23338619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).