About 3-(2-hydroxy-3,4-dimethyl-6-oxo-1-pyridinyl)benzenesulfonic acid
3-(2-hydroxy-3,4-dimethyl-6-oxo-1-pyridinyl)benzenesulfonic acid (PubChem CID 23338646) has the molecular formula C13H13NO5S
and a molecular weight of 295.32 g/mol. Its IUPAC name is 3-(2-hydroxy-3,4-dimethyl-6-oxo-1-pyridinyl)benzenesulfonic acid.
Molecular Properties
| Compound Name | 3-(2-hydroxy-3,4-dimethyl-6-oxo-1-pyridinyl)benzenesulfonic acid |
| PubChem CID | 23338646 |
| Molecular Formula | C13H13NO5S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 3-(2-hydroxy-3,4-dimethyl-6-oxo-1-pyridinyl)benzenesulfonic acid |
| SMILES | Cc1cc(=O)n(-c2cccc(S(=O)(=O)O)c2)c(O)c1C |
| InChI | InChI=1S/C13H13NO5S/c1-8-6-12(15)14(13(16)9(8)2)10-4-3-5-11(7-10)20(17,18)19/h3-7,16H,1-2H3,(H,17,18,19) |
| InChIKey | LHAYQBOJLZLZNT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-hydroxy-3,4-dimethyl-6-oxo-1-pyridinyl)benzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-hydroxy-3,4-dimethyl-6-oxo-1-pyridinyl)benzenesulfonic acid?
The IUPAC name of 3-(2-hydroxy-3,4-dimethyl-6-oxo-1-pyridinyl)benzenesulfonic acid (CID 23338646) is 3-(2-hydroxy-3,4-dimethyl-6-oxo-1-pyridinyl)benzenesulfonic acid.
What is the SMILES notation for 3-(2-hydroxy-3,4-dimethyl-6-oxo-1-pyridinyl)benzenesulfonic acid?
The canonical SMILES for 3-(2-hydroxy-3,4-dimethyl-6-oxo-1-pyridinyl)benzenesulfonic acid is Cc1cc(=O)n(-c2cccc(S(=O)(=O)O)c2)c(O)c1C.
What is the InChIKey of 3-(2-hydroxy-3,4-dimethyl-6-oxo-1-pyridinyl)benzenesulfonic acid?
The InChIKey is LHAYQBOJLZLZNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO5S/c1-8-6-12(15)14(13(16)9(8)2)10-4-3-5-11(7-10)20(17,18)19/h3-7,16H,1-2H3,(H,17,18,19).
What are the key properties of 3-(2-hydroxy-3,4-dimethyl-6-oxo-1-pyridinyl)benzenesulfonic acid?
3-(2-hydroxy-3,4-dimethyl-6-oxo-1-pyridinyl)benzenesulfonic acid has a molecular weight of 295.32 g/mol, XLogP of 1.41, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-hydroxy-3,4-dimethyl-6-oxo-1-pyridinyl)benzenesulfonic acid is sourced from PubChem (CID 23338646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).